| Name | (-)-scopolamine hydrobromide trihydrate |
| Synonyms | Hyosol Tranaxine SCOPOLAMINE HBR (-)-Scopolamine, HBr hyoscine hydrobromide Hyocine f hydrobromide ScopolaMine-d3 HBr 3H2O Scopolamine hydrobromide ScopolaMine HBr Trihydrate (-)-scopolamine hydrobromide trihydrate 9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]non-7-yl 3-hydroxy-2-phenylpropanoate hydrochloride Hyoscine HydrobroMide Trihydrate, (1α,2β,4β,5α,7β)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl Ester HydrobroMide Trihydrate benzeneacetic acid, alpha-(hydroxymethyl)-, bromide, (1S,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]non-7-yl ester, (alphaS)- |
| CAS | 114-49-8 |
| EINECS | 204-050-6 |
| InChI | InChI=1/C17H21NO4.BrH/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;/h2-6,11-16,19H,7-9H2,1H3;1H/t11-,12-,13+,14?,15-,16?;/m1./s1 |
| Molecular Formula | C17H21NO4.BrH |
| Molar Mass | 384.26 |
| Melting Point | 195-199°C (dry matter)(lit.) |
| Boling Point | 487.7°C at 760 mmHg |
| Specific Rotation(α) | D25 -24 to -26° (c = 5, calculated on anhydrous basis) |
| Flash Point | 248.8°C |
| Solubility | H2O: 50mg/mL |
| Vapor Presure | 2.51E-10mmHg at 25°C |
| Appearance | powder |
| Color | white to off-white |
| Storage Condition | Store at RT |
| Physical and Chemical Properties | Colorless transparent crystal or white crystalline powder, odorless, bitter, slightly weathered in dry air. MP 195 ° C (decomposition), specific optical rotation [α]25D-24 ° -26 °(5%, water). Soluble in water, acidic aqueous solution, soluble in ethanol, slightly soluble in chloroform, insoluble in ether. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36 - Wear suitable protective clothing. |
| UN IDs | UN 1544 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | YM4550000 |
| FLUKA BRAND F CODES | 3-8 |
| HS Code | 2939800000 |
| Toxicity | LD50 in rats (mg/kg): 3800 s.c. (Stockhaus, Wick) |